About ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid
ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid (PubChem CID 144720636) has the molecular formula C11H24O5S
and a molecular weight of 268.37 g/mol. Its IUPAC name is ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid.
Molecular Properties
| Compound Name | ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid |
| PubChem CID | 144720636 |
| Molecular Formula | C11H24O5S |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid |
| SMILES | CC.COC1C(O)CC(CO)OC1C.O=CS |
| InChI | InChI=1S/C8H16O4.C2H6.CH2OS/c1-5-8(11-2)7(10)3-6(4-9)12-5;1-2;2-1-3/h5-10H,3-4H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | OLTWCUPGPJQAGL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid?
The IUPAC name of ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid (CID 144720636) is ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid.
What is the SMILES notation for ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid?
The canonical SMILES for ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid is CC.COC1C(O)CC(CO)OC1C.O=CS.
What is the InChIKey of ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid?
The InChIKey is OLTWCUPGPJQAGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O4.C2H6.CH2OS/c1-5-8(11-2)7(10)3-6(4-9)12-5;1-2;2-1-3/h5-10H,3-4H2,1-2H3;1-2H3;1H,(H,2,3).
What are the key properties of ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid?
ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid has a molecular weight of 268.37 g/mol, XLogP of 0.66, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-(hydroxymethyl)-3-methoxy-2-methyloxan-4-ol;methanethioic S-acid is sourced from PubChem (CID 144720636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).