C9H20O4 — CID 143276488
ethane;6-(hydroxymethyl)-2-methyloxane-3,4-diol (PubChem CID 143276488) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is ethane;6-(hydroxymethyl)-2-methyloxane-3,4-diol.
| Compound Name | ethane;6-(hydroxymethyl)-2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 143276488 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | ethane;6-(hydroxymethyl)-2-methyloxane-3,4-diol |
| SMILES | CC.CC1OC(CO)CC(O)C1O |
| InChI | InChI=1S/C7H14O4.C2H6/c1-4-7(10)6(9)2-5(3-8)11-4;1-2/h4-10H,2-3H2,1H3;1-2H3 |
| InChIKey | XNTGFVQDZJGXLF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |