C15H20F3NO4 — CID 10337017
[(2S,3S,4S,6S)-2-methyl-6-[(2E)-penta-2,4-dienyl]-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 10337017) has the molecular formula C15H20F3NO4 and a molecular weight of 335.32 g/mol. Its IUPAC name is [(2S,3S,4S,6S)-2-methyl-6-[(2E)-penta-2,4-dienyl]-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,6S)-2-methyl-6-[(2E)-penta-2,4-dienyl]-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 10337017 |
| Molecular Formula | C15H20F3NO4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | [(2S,3S,4S,6S)-2-methyl-6-[(2E)-penta-2,4-dienyl]-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | C=C/C=C/C[C@H]1C[C@H](NC(=O)C(F)(F)F)[C@H](OC(C)=O)[C@H](C)O1 |
| InChI | InChI=1S/C15H20F3NO4/c1-4-5-6-7-11-8-12(19-14(21)15(16,17)18)13(9(2)22-11)23-10(3)20/h4-6,9,11-13H,1,7-8H2,2-3H3,(H,19,21)/b6-5+/t9-,11-,12-,13+/m0/s1 |
| InChIKey | JEDDNANHMQMZSV-ZCPOYEJXSA-N |
| XLogP | 2.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|