C30H31F3N2O10 — CID 162419549
[(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3-amino-5,12-dihydroxy-6,11-dioxo-2,4,5a,11a-tetrahydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate (PubChem CID 162419549) has the molecular formula C30H31F3N2O10 and a molecular weight of 636.58 g/mol. Its IUPAC name is [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3-amino-5,12-dihydroxy-6,11-dioxo-2,4,5a,11a-tetrahydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3-amino-5,12-dihydroxy-6,11-dioxo-2,4,5a,11a-tetrahydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 162419549 |
| Molecular Formula | C30H31F3N2O10 |
| Molecular Weight | 636.58 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | [(2S,3S,4S,6R)-6-[[(1S,3S)-3-acetyl-3-amino-5,12-dihydroxy-6,11-dioxo-2,4,5a,11a-tetrahydro-1H-tetracen-1-yl]oxy]-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](NC(=O)C(F)(F)F)C[C@H](O[C@H]2C[C@](N)(C(C)=O)CC3=C(O)C4C(=O)c5ccccc5C(=O)C4C(O)=C32)O[C@H]1C |
| InChI | InChI=1S/C30H31F3N2O10/c1-11-27(44-13(3)37)17(35-28(42)30(31,32)33)8-19(43-11)45-18-10-29(34,12(2)36)9-16-20(18)26(41)22-21(25(16)40)23(38)14-6-4-5-7-15(14)24(22)39/h4-7,11,17-19,21-22,27,40-41H,8-10,34H2,1-3H3,(H,35,42)/t11-,17-,18-,19-,21?,22?,27+,29-/m0/s1 |
| InChIKey | ITVMKPSJTUDXAT-VQUQXOATSA-N |
| XLogP | 2.52 |
| TPSA | 191.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.58 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|