C11H14F6N2O5 — CID 131883764
2,2,2-trifluoro-N-[[(2R,3S,4S,6S)-3-hydroxy-6-methoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl]acetamide (PubChem CID 131883764) has the molecular formula C11H14F6N2O5 and a molecular weight of 368.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[[(2R,3S,4S,6S)-3-hydroxy-6-methoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[[(2R,3S,4S,6S)-3-hydroxy-6-methoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 131883764 |
| Molecular Formula | C11H14F6N2O5 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[[(2R,3S,4S,6S)-3-hydroxy-6-methoxy-4-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl]acetamide |
| SMILES | CO[C@@H]1C[C@H](NC(=O)C(F)(F)F)[C@H](O)[C@@H](CNC(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C11H14F6N2O5/c1-23-6-2-4(19-9(22)11(15,16)17)7(20)5(24-6)3-18-8(21)10(12,13)14/h4-7,20H,2-3H2,1H3,(H,18,21)(H,19,22)/t4-,5+,6-,7-/m0/s1 |
| InChIKey | VPTWVVAMILJEOL-VZFHVOOUSA-N |
| XLogP | -0.17 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |