C8H16O3 — CID 58831559
6-methoxy-2,4-dimethyloxan-3-ol (PubChem CID 58831559) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 6-methoxy-2,4-dimethyloxan-3-ol.
| Compound Name | 6-methoxy-2,4-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 58831559 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 6-methoxy-2,4-dimethyloxan-3-ol |
| SMILES | COC1CC(C)C(O)C(C)O1 |
| InChI | InChI=1S/C8H16O3/c1-5-4-7(10-3)11-6(2)8(5)9/h5-9H,4H2,1-3H3 |
| InChIKey | ADQJTPHMBDYGQB-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |