C10H18O4 — CID 20577444
(6-methoxy-2,4-dimethyloxan-3-yl) acetate (PubChem CID 20577444) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (6-methoxy-2,4-dimethyloxan-3-yl) acetate.
| Compound Name | (6-methoxy-2,4-dimethyloxan-3-yl) acetate |
|---|---|
| PubChem CID | 20577444 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (6-methoxy-2,4-dimethyloxan-3-yl) acetate |
| SMILES | COC1CC(C)C(OC(C)=O)C(C)O1 |
| InChI | InChI=1S/C10H18O4/c1-6-5-9(12-4)13-7(2)10(6)14-8(3)11/h6-7,9-10H,5H2,1-4H3 |
| InChIKey | DIMVVWVOVNQHIG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |