C7H15NO3 — CID 131124380
(1R)-1-[(2R,3R,5R)-3-amino-5-methoxyoxolan-2-yl]ethanol (PubChem CID 131124380) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is (1R)-1-[(2R,3R,5R)-3-amino-5-methoxyoxolan-2-yl]ethanol.
| Compound Name | (1R)-1-[(2R,3R,5R)-3-amino-5-methoxyoxolan-2-yl]ethanol |
|---|---|
| PubChem CID | 131124380 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (1R)-1-[(2R,3R,5R)-3-amino-5-methoxyoxolan-2-yl]ethanol |
| SMILES | CO[C@H]1C[C@@H](N)[C@H]([C@@H](C)O)O1 |
| InChI | InChI=1S/C7H15NO3/c1-4(9)7-5(8)3-6(10-2)11-7/h4-7,9H,3,8H2,1-2H3/t4-,5-,6-,7+/m1/s1 |
| InChIKey | DDZGVSPAILKURG-GBNDHIKLSA-N |
| XLogP | -0.54 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |