C8H16O4 — CID 15927279
(2R,3R,5R)-5-methoxy-2-[(1R)-1-methoxyethyl]oxolan-3-ol (PubChem CID 15927279) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (2R,3R,5R)-5-methoxy-2-[(1R)-1-methoxyethyl]oxolan-3-ol.
| Compound Name | (2R,3R,5R)-5-methoxy-2-[(1R)-1-methoxyethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 15927279 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2R,3R,5R)-5-methoxy-2-[(1R)-1-methoxyethyl]oxolan-3-ol |
| SMILES | CO[C@H]1C[C@@H](O)[C@H]([C@@H](C)OC)O1 |
| InChI | InChI=1S/C8H16O4/c1-5(10-2)8-6(9)4-7(11-3)12-8/h5-9H,4H2,1-3H3/t5-,6-,7-,8+/m1/s1 |
| InChIKey | MCCBNYMNAVOGBQ-XUTVFYLZSA-N |
| XLogP | 0.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |