C7H16N2O2 — CID 130949398
(2R,3S,5R)-2-[(1S)-1-aminoethyl]-5-methoxyoxolan-3-amine (PubChem CID 130949398) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (2R,3S,5R)-2-[(1S)-1-aminoethyl]-5-methoxyoxolan-3-amine.
| Compound Name | (2R,3S,5R)-2-[(1S)-1-aminoethyl]-5-methoxyoxolan-3-amine |
|---|---|
| PubChem CID | 130949398 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | (2R,3S,5R)-2-[(1S)-1-aminoethyl]-5-methoxyoxolan-3-amine |
| SMILES | CO[C@H]1C[C@H](N)[C@@H]([C@H](C)N)O1 |
| InChI | InChI=1S/C7H16N2O2/c1-4(8)7-5(9)3-6(10-2)11-7/h4-7H,3,8-9H2,1-2H3/t4-,5-,6+,7+/m0/s1 |
| InChIKey | AIJYQEJXLFWWIW-VWDOSNQTSA-N |
| XLogP | -0.58 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |