C7H13IO5 — CID 142600377
[(2R,3S,4R,6S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] hypoiodite (PubChem CID 142600377) has the molecular formula C7H13IO5 and a molecular weight of 304.08 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] hypoiodite.
| Compound Name | [(2R,3S,4R,6S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] hypoiodite |
|---|---|
| PubChem CID | 142600377 |
| Molecular Formula | C7H13IO5 |
| Molecular Weight | 304.08 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | [(2R,3S,4R,6S)-4-hydroxy-2-(hydroxymethyl)-6-methoxyoxan-3-yl] hypoiodite |
| SMILES | CO[C@@H]1C[C@@H](O)[C@H](OI)[C@@H](CO)O1 |
| InChI | InChI=1S/C7H13IO5/c1-11-6-2-4(10)7(13-8)5(3-9)12-6/h4-7,9-10H,2-3H2,1H3/t4-,5-,6+,7+/m1/s1 |
| InChIKey | BQQMAOVWIIJXEX-JWXFUTCRSA-N |
| XLogP | -0.16 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.08 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|