C7H13IO4 — CID 142600724
[(2S,4S,6R)-2-(hydroxymethyl)-6-methoxyoxan-4-yl] hypoiodite (PubChem CID 142600724) has the molecular formula C7H13IO4 and a molecular weight of 288.08 g/mol. Its IUPAC name is [(2S,4S,6R)-2-(hydroxymethyl)-6-methoxyoxan-4-yl] hypoiodite.
| Compound Name | [(2S,4S,6R)-2-(hydroxymethyl)-6-methoxyoxan-4-yl] hypoiodite |
|---|---|
| PubChem CID | 142600724 |
| Molecular Formula | C7H13IO4 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | [(2S,4S,6R)-2-(hydroxymethyl)-6-methoxyoxan-4-yl] hypoiodite |
| SMILES | CO[C@H]1C[C@@H](OI)C[C@@H](CO)O1 |
| InChI | InChI=1S/C7H13IO4/c1-10-7-3-5(12-8)2-6(4-9)11-7/h5-7,9H,2-4H2,1H3/t5-,6-,7+/m0/s1 |
| InChIKey | TWCUXCRACCOVKG-LYFYHCNISA-N |
| XLogP | 0.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|