C8H14O4 — CID 10511417
(2R,3aR,6aS)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4,5-diol (PubChem CID 10511417) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is (2R,3aR,6aS)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4,5-diol.
| Compound Name | (2R,3aR,6aS)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4,5-diol |
|---|---|
| PubChem CID | 10511417 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (2R,3aR,6aS)-2-methoxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4,5-diol |
| SMILES | CO[C@H]1C[C@@H]2C(O)C(O)C[C@@H]2O1 |
| InChI | InChI=1S/C8H14O4/c1-11-7-2-4-6(12-7)3-5(9)8(4)10/h4-10H,2-3H2,1H3/t4-,5?,6-,7+,8?/m0/s1 |
| InChIKey | MAMNBEUJXNFFSB-BRFCOKSNSA-N |
| XLogP | -0.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |