C8H14O7 — CID 139696884
1-[(2R,3S,5S,6S)-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone (PubChem CID 139696884) has the molecular formula C8H14O7 and a molecular weight of 222.19 g/mol. Its IUPAC name is 1-[(2R,3S,5S,6S)-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone.
| Compound Name | 1-[(2R,3S,5S,6S)-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone |
|---|---|
| PubChem CID | 139696884 |
| Molecular Formula | C8H14O7 |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 1-[(2R,3S,5S,6S)-1,2,3,4,5,6-hexahydroxycyclohexyl]ethanone |
| SMILES | CC(=O)C1(O)[C@H](O)[C@@H](O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14O7/c1-2(9)8(15)6(13)4(11)3(10)5(12)7(8)14/h3-7,10-15H,1H3/t3?,4-,5-,6-,7+,8?/m0/s1 |
| InChIKey | ASEHVUQRAZBQFU-MICXMKHPSA-N |
| XLogP | -3.88 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |