C7H13NO4 — CID 70142980
1-(3,4,5-trihydroxypiperidin-4-yl)ethanone (PubChem CID 70142980) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 1-(3,4,5-trihydroxypiperidin-4-yl)ethanone.
| Compound Name | 1-(3,4,5-trihydroxypiperidin-4-yl)ethanone |
|---|---|
| PubChem CID | 70142980 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 1-(3,4,5-trihydroxypiperidin-4-yl)ethanone |
| SMILES | CC(=O)C1(O)C(O)CNCC1O |
| InChI | InChI=1S/C7H13NO4/c1-4(9)7(12)5(10)2-8-3-6(7)11/h5-6,8,10-12H,2-3H2,1H3 |
| InChIKey | HCHXRTXYHPJKRZ-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |