About azetidin-3-ol;ethane;3-methylazetidin-3-ol
azetidin-3-ol;ethane;3-methylazetidin-3-ol (PubChem CID 145216921) has the molecular formula C9H22N2O2
and a molecular weight of 190.29 g/mol. Its IUPAC name is azetidin-3-ol;ethane;3-methylazetidin-3-ol.
Molecular Properties
| Compound Name | azetidin-3-ol;ethane;3-methylazetidin-3-ol |
| PubChem CID | 145216921 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | azetidin-3-ol;ethane;3-methylazetidin-3-ol |
| SMILES | CC.CC1(O)CNC1.OC1CNC1 |
| InChI | InChI=1S/C4H9NO.C3H7NO.C2H6/c1-4(6)2-5-3-4;5-3-1-4-2-3;1-2/h5-6H,2-3H2,1H3;3-5H,1-2H2;1-2H3 |
| InChIKey | UHYUPBXLADFZAQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azetidin-3-ol;ethane;3-methylazetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-3-ol;ethane;3-methylazetidin-3-ol?
The IUPAC name of azetidin-3-ol;ethane;3-methylazetidin-3-ol (CID 145216921) is azetidin-3-ol;ethane;3-methylazetidin-3-ol.
What is the SMILES notation for azetidin-3-ol;ethane;3-methylazetidin-3-ol?
The canonical SMILES for azetidin-3-ol;ethane;3-methylazetidin-3-ol is CC.CC1(O)CNC1.OC1CNC1.
What is the InChIKey of azetidin-3-ol;ethane;3-methylazetidin-3-ol?
The InChIKey is UHYUPBXLADFZAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C3H7NO.C2H6/c1-4(6)2-5-3-4;5-3-1-4-2-3;1-2/h5-6H,2-3H2,1H3;3-5H,1-2H2;1-2H3.
What are the key properties of azetidin-3-ol;ethane;3-methylazetidin-3-ol?
azetidin-3-ol;ethane;3-methylazetidin-3-ol has a molecular weight of 190.29 g/mol, XLogP of -0.68, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-3-ol;ethane;3-methylazetidin-3-ol is sourced from PubChem (CID 145216921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).