C5H11NO4 — CID 55287322
(4S,5R)-piperidine-3,3,4,5-tetrol (PubChem CID 55287322) has the molecular formula C5H11NO4 and a molecular weight of 149.15 g/mol. Its IUPAC name is (4S,5R)-piperidine-3,3,4,5-tetrol.
| Compound Name | (4S,5R)-piperidine-3,3,4,5-tetrol |
|---|---|
| PubChem CID | 55287322 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | (4S,5R)-piperidine-3,3,4,5-tetrol |
| SMILES | O[C@@H]1CNCC(O)(O)[C@H]1O |
| InChI | InChI=1S/C5H11NO4/c7-3-1-6-2-5(9,10)4(3)8/h3-4,6-10H,1-2H2/t3-,4+/m1/s1 |
| InChIKey | RLSAGAJZOLWEII-DMTCNVIQSA-N |
| XLogP | -3.01 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|