C5H9NO5 — CID 58111748
(2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid (PubChem CID 58111748) has the molecular formula C5H9NO5 and a molecular weight of 163.13 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 58111748 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@]1(O)NC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H9NO5/c7-2-1-6-5(11,3(2)8)4(9)10/h2-3,6-8,11H,1H2,(H,9,10)/t2-,3-,5+/m1/s1 |
| InChIKey | XUYDXLXUGLRBCM-KUCRYNDESA-N |
| XLogP | -2.92 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |