(2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid

C5H9NO5 — CID 58111748

IUPAC(2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@]1(O)NC[C@@H](O)[C@H]1O
InChIInChI=1S/C5H9NO5/c7-2-1-6-5(11,3(2)8)4(9)10/h2-3,6-8,11H,1H2,(H,9,10)/t2-,3-,5+/m1/s1
InChIKeyXUYDXLXUGLRBCM-KUCRYNDESA-N
MW163.13 g/mol
LogP-2.92
Rot. Bonds1

About (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid

(2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid (PubChem CID 58111748) has the molecular formula C5H9NO5 and a molecular weight of 163.13 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid
PubChem CID58111748
Molecular FormulaC5H9NO5
Molecular Weight163.13 g/mol
Exact Mass163.05
IUPAC Name(2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@]1(O)NC[C@@H](O)[C@H]1O
InChIInChI=1S/C5H9NO5/c7-2-1-6-5(11,3(2)8)4(9)10/h2-3,6-8,11H,1H2,(H,9,10)/t2-,3-,5+/m1/s1
InChIKeyXUYDXLXUGLRBCM-KUCRYNDESA-N
XLogP-2.92
TPSA110.02 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.13
LogP ≤ 5-2.92
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid?
The IUPAC name of (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid (CID 58111748) is (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid is O=C(O)[C@]1(O)NC[C@@H](O)[C@H]1O.
What is the InChIKey of (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid?
The InChIKey is XUYDXLXUGLRBCM-KUCRYNDESA-N. The full InChI is InChI=1S/C5H9NO5/c7-2-1-6-5(11,3(2)8)4(9)10/h2-3,6-8,11H,1H2,(H,9,10)/t2-,3-,5+/m1/s1.
What are the key properties of (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid?
(2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid has a molecular weight of 163.13 g/mol, XLogP of -2.92, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R,4R)-2,3,4-trihydroxypyrrolidine-2-carboxylic acid is sourced from PubChem (CID 58111748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).