C7H8F3NO2 — CID 82400684
6-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid (PubChem CID 82400684) has the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid.
| Compound Name | 6-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
|---|---|
| PubChem CID | 82400684 |
| Molecular Formula | C7H8F3NO2 |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 6-(trifluoromethyl)-3-azabicyclo[3.1.0]hexane-6-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)C2CNCC21 |
| InChI | InChI=1S/C7H8F3NO2/c8-7(9,10)6(5(12)13)3-1-11-2-4(3)6/h3-4,11H,1-2H2,(H,12,13) |
| InChIKey | BZSJBNGVGZNMTO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |