C6H8F5NO2 — CID 155943912
3-(difluoromethyl)azetidine;2,2,2-trifluoroacetic acid (PubChem CID 155943912) has the molecular formula C6H8F5NO2 and a molecular weight of 221.12 g/mol. Its IUPAC name is 3-(difluoromethyl)azetidine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(difluoromethyl)azetidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155943912 |
| Molecular Formula | C6H8F5NO2 |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 3-(difluoromethyl)azetidine;2,2,2-trifluoroacetic acid |
| SMILES | FC(F)C1CNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H7F2N.C2HF3O2/c5-4(6)3-1-7-2-3;3-2(4,5)1(6)7/h3-4,7H,1-2H2;(H,6,7) |
| InChIKey | ZGMPWJLMRVYMPN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |