3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid

C9H12F3NO2 — CID 170912841

IUPAC3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid
SMILESC#CC(C)C1CNC1.O=C(O)C(F)(F)F
InChIInChI=1S/C7H11N.C2HF3O2/c1-3-6(2)7-4-8-5-7;3-2(4,5)1(6)7/h1,6-8H,4-5H2,2H3;(H,6,7)
InChIKeyVEXDGYSTTHTMCX-UHFFFAOYSA-N
MW223.19 g/mol
LogP1.11
Rot. Bonds1

About 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid

3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid (PubChem CID 170912841) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid
PubChem CID170912841
Molecular FormulaC9H12F3NO2
Molecular Weight223.19 g/mol
Exact Mass223.08
IUPAC Name3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid
SMILESC#CC(C)C1CNC1.O=C(O)C(F)(F)F
InChIInChI=1S/C7H11N.C2HF3O2/c1-3-6(2)7-4-8-5-7;3-2(4,5)1(6)7/h1,6-8H,4-5H2,2H3;(H,6,7)
InChIKeyVEXDGYSTTHTMCX-UHFFFAOYSA-N
XLogP1.11
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.19
LogP ≤ 51.11
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid?
The IUPAC name of 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid (CID 170912841) is 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid is C#CC(C)C1CNC1.O=C(O)C(F)(F)F.
What is the InChIKey of 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid?
The InChIKey is VEXDGYSTTHTMCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.C2HF3O2/c1-3-6(2)7-4-8-5-7;3-2(4,5)1(6)7/h1,6-8H,4-5H2,2H3;(H,6,7).
What are the key properties of 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid?
3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid has a molecular weight of 223.19 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 170912841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).