C9H12F3NO2 — CID 170912841
3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid (PubChem CID 170912841) has the molecular formula C9H12F3NO2 and a molecular weight of 223.19 g/mol. Its IUPAC name is 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170912841 |
| Molecular Formula | C9H12F3NO2 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-but-3-yn-2-ylazetidine;2,2,2-trifluoroacetic acid |
| SMILES | C#CC(C)C1CNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H11N.C2HF3O2/c1-3-6(2)7-4-8-5-7;3-2(4,5)1(6)7/h1,6-8H,4-5H2,2H3;(H,6,7) |
| InChIKey | VEXDGYSTTHTMCX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|