C9H14O8 — CID 141203963
methyl (2S,3S,4S,5R,6S)-6-acetyl-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 141203963) has the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-6-acetyl-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-6-acetyl-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 141203963 |
| Molecular Formula | C9H14O8 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-6-acetyl-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@](O)(C(C)=O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H14O8/c1-3(10)9(15)7(13)5(12)4(11)6(17-9)8(14)16-2/h4-7,11-13,15H,1-2H3/t4-,5-,6-,7+,9+/m0/s1 |
| InChIKey | HAIGPLNXBMPLEZ-GDOKVURESA-N |
| XLogP | -3.08 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |