C18H32O14 — CID 157117652
methyl (2R,3S,6S)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate;methyl (3S,4R,6R)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate (PubChem CID 157117652) has the molecular formula C18H32O14 and a molecular weight of 472.44 g/mol. Its IUPAC name is methyl (2R,3S,6S)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate;methyl (3S,4R,6R)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate.
| Compound Name | methyl (2R,3S,6S)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate;methyl (3S,4R,6R)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 157117652 |
| Molecular Formula | C18H32O14 |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | methyl (2R,3S,6S)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate;methyl (3S,4R,6R)-3,6-dihydroxy-4,5-dimethoxyoxane-2-carboxylate |
| SMILES | COC(=O)C1O[C@@H](O)C(OC)[C@H](OC)[C@@H]1O.COC(=O)[C@@H]1O[C@H](O)C(OC)C(OC)[C@@H]1O |
| InChI | InChI=1S/2C9H16O7/c2*1-13-5-4(10)6(8(11)15-3)16-9(12)7(5)14-2/h2*4-7,9-10,12H,1-3H3/t4-,5?,6+,7?,9-;4-,5+,6?,7?,9+/m00/s1 |
| InChIKey | AHPAPKNSJDBZJJ-LRINUGRLSA-N |
| XLogP | -3.46 |
| TPSA | 188.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |