C13H15BrO2 — CID 22525560
(1'R,2'S,3'S,5'S,6'R,8'R,9'R,10'R)-1'-bromospiro[1,3-dioxolane-2,7'-pentacyclo[6.3.0.02,6.03,10.05,9]undecane] (PubChem CID 22525560) has the molecular formula C13H15BrO2 and a molecular weight of 283.17 g/mol. Its IUPAC name is (1'R,2'S,3'S,5'S,6'R,8'R,9'R,10'R)-1'-bromospiro[1,3-dioxolane-2,7'-pentacyclo[6.3.0.02,6.03,10.05,9]undecane].
| Compound Name | (1'R,2'S,3'S,5'S,6'R,8'R,9'R,10'R)-1'-bromospiro[1,3-dioxolane-2,7'-pentacyclo[6.3.0.02,6.03,10.05,9]undecane] |
|---|---|
| PubChem CID | 22525560 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (1'R,2'S,3'S,5'S,6'R,8'R,9'R,10'R)-1'-bromospiro[1,3-dioxolane-2,7'-pentacyclo[6.3.0.02,6.03,10.05,9]undecane] |
| SMILES | Br[C@@]12C[C@@H]3[C@@H]4C[C@H]5[C@@H]3[C@@H]1C1(OCCO1)[C@H]5[C@H]42 |
| InChI | InChI=1S/C13H15BrO2/c14-12-4-7-5-3-6-8(7)11(12)13(10(6)9(5)12)15-1-2-16-13/h5-11H,1-4H2/t5-,6-,7+,8-,9-,10+,11-,12+/m0/s1 |
| InChIKey | NLSPDGFHTAWCDB-YZXKAZTKSA-N |
| XLogP | 2.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|