C10H12Br2O2 — CID 135037744
(1'S,2'R,4'S,6'S)-3',3'-dibromospiro[1,3-dioxolane-2,7'-tricyclo[4.2.0.02,4]octane] (PubChem CID 135037744) has the molecular formula C10H12Br2O2 and a molecular weight of 324.01 g/mol. Its IUPAC name is (1'S,2'R,4'S,6'S)-3',3'-dibromospiro[1,3-dioxolane-2,7'-tricyclo[4.2.0.02,4]octane].
| Compound Name | (1'S,2'R,4'S,6'S)-3',3'-dibromospiro[1,3-dioxolane-2,7'-tricyclo[4.2.0.02,4]octane] |
|---|---|
| PubChem CID | 135037744 |
| Molecular Formula | C10H12Br2O2 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | (1'S,2'R,4'S,6'S)-3',3'-dibromospiro[1,3-dioxolane-2,7'-tricyclo[4.2.0.02,4]octane] |
| SMILES | BrC1(Br)[C@@H]2[C@H]3CC4(OCCO4)[C@H]3C[C@@H]21 |
| InChI | InChI=1S/C10H12Br2O2/c11-10(12)7-3-6-5(8(7)10)4-9(6)13-1-2-14-9/h5-8H,1-4H2/t5-,6-,7-,8+/m0/s1 |
| InChIKey | VHRIRGVPWLWYHA-DKXJUACHSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|