C15H18O3 — CID 10729106
(1'R,2'R,3'S,5'R,6'R,8'R,9'S,10'R,11'R,12'R)-spiro[1,3-dioxolane-2,7'-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecane]-1'-ol (PubChem CID 10729106) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1'R,2'R,3'S,5'R,6'R,8'R,9'S,10'R,11'R,12'R)-spiro[1,3-dioxolane-2,7'-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecane]-1'-ol.
| Compound Name | (1'R,2'R,3'S,5'R,6'R,8'R,9'S,10'R,11'R,12'R)-spiro[1,3-dioxolane-2,7'-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecane]-1'-ol |
|---|---|
| PubChem CID | 10729106 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (1'R,2'R,3'S,5'R,6'R,8'R,9'S,10'R,11'R,12'R)-spiro[1,3-dioxolane-2,7'-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecane]-1'-ol |
| SMILES | O[C@@]12C[C@@H]3[C@@H]4[C@@H]5C[C@@H]6[C@H]4[C@H]3[C@H]1C1(OCCO1)[C@H]6[C@@H]52 |
| InChI | InChI=1S/C15H18O3/c16-14-4-7-8-5-3-6-9(8)10(7)13(14)15(12(6)11(5)14)17-1-2-18-15/h5-13,16H,1-4H2/t5-,6+,7+,8-,9+,10-,11+,12+,13+,14+/m0/s1 |
| InChIKey | OFDLACMKLPQUCW-XZFRXDJVSA-N |
| XLogP | 0.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|