C12H15BrO2 — CID 124925298
(1R,2S,3R,5S,6S,7S,8R,9S,10S,11S)-11-bromo-7-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecane-1,7-diol (PubChem CID 124925298) has the molecular formula C12H15BrO2 and a molecular weight of 271.15 g/mol. Its IUPAC name is (1R,2S,3R,5S,6S,7S,8R,9S,10S,11S)-11-bromo-7-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecane-1,7-diol.
| Compound Name | (1R,2S,3R,5S,6S,7S,8R,9S,10S,11S)-11-bromo-7-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecane-1,7-diol |
|---|---|
| PubChem CID | 124925298 |
| Molecular Formula | C12H15BrO2 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.03 |
| IUPAC Name | (1R,2S,3R,5S,6S,7S,8R,9S,10S,11S)-11-bromo-7-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecane-1,7-diol |
| SMILES | C[C@]1(O)[C@H]2[C@H]3C[C@H]4[C@H]5[C@@H]3[C@H]1[C@](O)([C@@H]42)[C@H]5Br |
| InChI | InChI=1S/C12H15BrO2/c1-11(14)7-3-2-4-6-5(3)9(11)12(15,8(4)7)10(6)13/h3-10,14-15H,2H2,1H3/t3-,4-,5+,6-,7-,8-,9+,10-,11-,12+/m0/s1 |
| InChIKey | QPWVLPJYSXVTHC-BTJWQNELSA-N |
| XLogP | 1.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|