C12H14O3 — CID 124784892
(1'R,2'R,3'S,4'S,5'S,6'R,7'S,8'R,9'R)-spiro[1,3-dioxolane-2,10'-pentacyclo[5.3.0.02,5.03,9.04,8]decane]-6'-ol (PubChem CID 124784892) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (1'R,2'R,3'S,4'S,5'S,6'R,7'S,8'R,9'R)-spiro[1,3-dioxolane-2,10'-pentacyclo[5.3.0.02,5.03,9.04,8]decane]-6'-ol.
| Compound Name | (1'R,2'R,3'S,4'S,5'S,6'R,7'S,8'R,9'R)-spiro[1,3-dioxolane-2,10'-pentacyclo[5.3.0.02,5.03,9.04,8]decane]-6'-ol |
|---|---|
| PubChem CID | 124784892 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (1'R,2'R,3'S,4'S,5'S,6'R,7'S,8'R,9'R)-spiro[1,3-dioxolane-2,10'-pentacyclo[5.3.0.02,5.03,9.04,8]decane]-6'-ol |
| SMILES | O[C@@H]1[C@H]2[C@@H]3[C@@H]4[C@H]1[C@H]1[C@@H]2[C@H]3[C@H]4C12OCCO2 |
| InChI | InChI=1S/C12H14O3/c13-11-7-3-4-6(7)10-8(11)5(3)9(4)12(10)14-1-2-15-12/h3-11,13H,1-2H2/t3-,4-,5+,6+,7-,8-,9+,10+,11+/m0/s1 |
| InChIKey | BVIQFAVYZSALSY-ZKMCVBIZSA-N |
| XLogP | 0.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |