C17H18O2 — CID 10060885
12'-methylidenespiro[1,3-dioxolane-2,7'-heptacyclo[6.6.0.02,6.03,13.04,11.05,9.010,14]tetradecane] (PubChem CID 10060885) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 12'-methylidenespiro[1,3-dioxolane-2,7'-heptacyclo[6.6.0.02,6.03,13.04,11.05,9.010,14]tetradecane].
| Compound Name | 12'-methylidenespiro[1,3-dioxolane-2,7'-heptacyclo[6.6.0.02,6.03,13.04,11.05,9.010,14]tetradecane] |
|---|---|
| PubChem CID | 10060885 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 12'-methylidenespiro[1,3-dioxolane-2,7'-heptacyclo[6.6.0.02,6.03,13.04,11.05,9.010,14]tetradecane] |
| SMILES | C=C1C2C3C4C1C1C2C2C3C3C4C1C2C31OCCO1 |
| InChI | InChI=1S/C17H18O2/c1-4-5-7-9-6(4)10-8(5)12-11(7)15-13(9)14(10)16(12)17(15)18-2-3-19-17/h5-16H,1-3H2 |
| InChIKey | DFTABEYRBPVVLQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|