C14H15BrO4 — CID 129431522
CID 129431522 (PubChem CID 129431522) has the molecular formula C14H15BrO4 and a molecular weight of 327.17 g/mol.
| Compound Name | CID 129431522 |
|---|---|
| PubChem CID | 129431522 |
| Molecular Formula | C14H15BrO4 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | — |
| SMILES | Br[C@@]12[C@@H]3[C@@H]4[C@H]5[C@H]3[C@H]1[C@@H]([C@H]4C21OCCO1)C51OCCO1 |
| InChI | InChI=1S/C14H15BrO4/c15-12-7-5-8-6(7)10(14(12)18-3-4-19-14)11(9(5)12)13(8)16-1-2-17-13/h5-11H,1-4H2/t5-,6+,7-,8+,9-,10-,11-,12-/m0/s1 |
| InChIKey | INNKCRVAOQYOJR-ITUDHANMSA-N |
| XLogP | 0.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|