C13H12BrNO2 — CID 99945924
2-[(1'S,2'R,3'R,4'R,5'S,6'S,7'R,8'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]acetonitrile (PubChem CID 99945924) has the molecular formula C13H12BrNO2 and a molecular weight of 294.15 g/mol. Its IUPAC name is 2-[(1'S,2'R,3'R,4'R,5'S,6'S,7'R,8'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]acetonitrile.
| Compound Name | 2-[(1'S,2'R,3'R,4'R,5'S,6'S,7'R,8'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]acetonitrile |
|---|---|
| PubChem CID | 99945924 |
| Molecular Formula | C13H12BrNO2 |
| Molecular Weight | 294.15 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-[(1'S,2'R,3'R,4'R,5'S,6'S,7'R,8'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]acetonitrile |
| SMILES | N#CC[C@@]12[C@@H]3[C@H]4[C@H]5[C@H]1[C@H]5[C@](Br)([C@H]32)C41OCCO1 |
| InChI | InChI=1S/C13H12BrNO2/c14-12-7-5-6(7)11(1-2-15)9(10(11)12)8(5)13(12)16-3-4-17-13/h5-10H,1,3-4H2/t5-,6-,7-,8+,9+,10+,11-,12-/m0/s1 |
| InChIKey | YDPFGDILYCLPCM-WSCRXDJUSA-N |
| XLogP | 1.53 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.15 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|