C15H15BrO5 — CID 98480064
CID 98480064 (PubChem CID 98480064) has the molecular formula C15H15BrO5 and a molecular weight of 355.18 g/mol.
| Compound Name | CID 98480064 |
|---|---|
| PubChem CID | 98480064 |
| Molecular Formula | C15H15BrO5 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | — |
| SMILES | O=C[C@@]12[C@@H]3[C@@H]4[C@@H]1[C@H]1[C@H]([C@@H]3[C@@]4(Br)C13OCCO3)C21OCCO1 |
| InChI | InChI=1S/C15H15BrO5/c16-13-8-6-9(13)11-10(15(13)20-3-4-21-15)7(8)12(6,5-17)14(11)18-1-2-19-14/h5-11H,1-4H2/t6-,7-,8-,9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | OQPHQSHULHNIFS-MOQFVYMESA-N |
| XLogP | 0.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|