C23H22Br2N2O5 — CID 124836928
1,3-bis[(1'S,2'S,3'R,4'S,5'R,6'S,7'R,8'S)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]urea (PubChem CID 124836928) has the molecular formula C23H22Br2N2O5 and a molecular weight of 566.25 g/mol. Its IUPAC name is 1,3-bis[(1'S,2'S,3'R,4'S,5'R,6'S,7'R,8'S)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]urea.
| Compound Name | 1,3-bis[(1'S,2'S,3'R,4'S,5'R,6'S,7'R,8'S)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]urea |
|---|---|
| PubChem CID | 124836928 |
| Molecular Formula | C23H22Br2N2O5 |
| Molecular Weight | 566.25 g/mol |
| Exact Mass | 563.99 |
| IUPAC Name | 1,3-bis[(1'S,2'S,3'R,4'S,5'R,6'S,7'R,8'S)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,4.03,8.05,7]nonane]-4'-yl]urea |
| SMILES | O=C(N[C@]12[C@@H]3[C@@H]4[C@H]5[C@@H]1[C@@H]2[C@@](Br)([C@@H]43)C51OCCO1)N[C@]12[C@@H]3[C@@H]4[C@H]5[C@@H]1[C@@H]2[C@@](Br)([C@@H]43)C51OCCO1 |
| InChI | InChI=1S/C23H22Br2N2O5/c24-20-9-5-7(9)18(13(15(18)20)11(5)22(20)29-1-2-30-22)26-17(28)27-19-8-6-10(8)21(25)16(19)14(19)12(6)23(21)31-3-4-32-23/h5-16H,1-4H2,(H2,26,27,28)/t5-,6-,7+,8+,9-,10-,11-,12-,13+,14+,15-,16-,18+,19+,20-,21-/m0/s1 |
| InChIKey | RCJDUXLRIPBMPW-ADCFBTHDSA-N |
| XLogP | 1.05 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|