C12H20O3 — CID 22216407
(1'S,2'R,4'R)-1',7',7'-trimethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-ol (PubChem CID 22216407) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is (1'S,2'R,4'R)-1',7',7'-trimethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-ol.
| Compound Name | (1'S,2'R,4'R)-1',7',7'-trimethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-ol |
|---|---|
| PubChem CID | 22216407 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | (1'S,2'R,4'R)-1',7',7'-trimethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-ol |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@@H](O)C21OCCO1 |
| InChI | InChI=1S/C12H20O3/c1-10(2)8-4-5-11(10,3)9(13)12(8)14-6-7-15-12/h8-9,13H,4-7H2,1-3H3/t8-,9-,11-/m1/s1 |
| InChIKey | DKGQGPJMCDDSPT-FXPVBKGRSA-N |
| XLogP | 1.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |