C19H31LiO4 — CID 23716496
lithium (E)-3-methyl-1-[(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxybut-1-en-1-olate (PubChem CID 23716496) has the molecular formula C19H31LiO4 and a molecular weight of 330.39 g/mol. Its IUPAC name is lithium (E)-3-methyl-1-[(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxybut-1-en-1-olate.
| Compound Name | lithium (E)-3-methyl-1-[(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxybut-1-en-1-olate |
|---|---|
| PubChem CID | 23716496 |
| Molecular Formula | C19H31LiO4 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | lithium (E)-3-methyl-1-[(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl]oxybut-1-en-1-olate |
| SMILES | CC(C)/C=C(\[O-])O[C@@H]1C2(O[C@@H](C)[C@@H](C)O2)[C@H]2CC[C@]1(C)C2(C)C.[Li+] |
| InChI | InChI=1S/C19H32O4.Li/c1-11(2)10-15(20)21-16-18(7)9-8-14(17(18,5)6)19(16)22-12(3)13(4)23-19;/h10-14,16,20H,8-9H2,1-7H3;/q;+1/p-1/b15-10+;/t12-,13+,14-,16-,18-,19?;/m0./s1 |
| InChIKey | XVHKEIWMOBANEN-RZYRSTJNSA-M |
| XLogP | 0.21 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|