C17H26N2O4 — CID 25216335
(1S,2S,5R,6S,9R,10R,11S)-5,13,13-trimethyl-11-nitro-10-propan-2-yl-7-oxa-12-azatetracyclo[7.2.1.12,5.01,6]tridecan-8-one (PubChem CID 25216335) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is (1S,2S,5R,6S,9R,10R,11S)-5,13,13-trimethyl-11-nitro-10-propan-2-yl-7-oxa-12-azatetracyclo[7.2.1.12,5.01,6]tridecan-8-one.
| Compound Name | (1S,2S,5R,6S,9R,10R,11S)-5,13,13-trimethyl-11-nitro-10-propan-2-yl-7-oxa-12-azatetracyclo[7.2.1.12,5.01,6]tridecan-8-one |
|---|---|
| PubChem CID | 25216335 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | (1S,2S,5R,6S,9R,10R,11S)-5,13,13-trimethyl-11-nitro-10-propan-2-yl-7-oxa-12-azatetracyclo[7.2.1.12,5.01,6]tridecan-8-one |
| SMILES | CC(C)[C@H]1[C@H]([N+](=O)[O-])[C@]23N[C@H]1C(=O)O[C@H]2[C@]1(C)CC[C@H]3C1(C)C |
| InChI | InChI=1S/C17H26N2O4/c1-8(2)10-11-13(20)23-14-16(5)7-6-9(15(16,3)4)17(14,18-11)12(10)19(21)22/h8-12,14,18H,6-7H2,1-5H3/t9-,10+,11+,12-,14-,16-,17-/m0/s1 |
| InChIKey | AIGYARUCLLYNSI-CWYXSOHRSA-N |
| XLogP | 2.00 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|