C11H17NO2 — CID 23309785
(1S,4S)-N,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptan-2-imine oxide (PubChem CID 23309785) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is (1S,4S)-N,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptan-2-imine oxide.
| Compound Name | (1S,4S)-N,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptan-2-imine oxide |
|---|---|
| PubChem CID | 23309785 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | (1S,4S)-N,4,7,7-tetramethyl-3-oxobicyclo[2.2.1]heptan-2-imine oxide |
| SMILES | C/[N+]([O-])=C1\C(=O)[C@@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C11H17NO2/c1-10(2)7-5-6-11(10,3)9(13)8(7)12(4)14/h7H,5-6H2,1-4H3/b12-8+/t7-,11-/m1/s1 |
| InChIKey | VCMGIVPDDMGHGE-AIIBGLEGSA-N |
| XLogP | 1.59 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|