C23H31NO5 — CID 10644746
[(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate (PubChem CID 10644746) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is [(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate.
| Compound Name | [(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 10644746 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | [(1'R,2'S,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,3'-bicyclo[2.2.1]heptane]-2'-yl] 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)O[C@@H]1C2(O[C@@H](C)[C@@H](C)O2)[C@H]2CC[C@]1(C)C2(C)C)C(O)c1cccnc1 |
| InChI | InChI=1S/C23H31NO5/c1-13(18(25)16-8-7-11-24-12-16)19(26)27-20-22(6)10-9-17(21(22,4)5)23(20)28-14(2)15(3)29-23/h7-8,11-12,14-15,17-18,20,25H,1,9-10H2,2-6H3/t14-,15+,17-,18?,20-,22-,23?/m0/s1 |
| InChIKey | QJCSJDKLGIAKIT-WIJVZGQRSA-N |
| XLogP | 3.56 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|