C8H10NO4P — CID 18757044
(3-hydroxy-3-pyridin-3-ylprop-1-en-2-yl)phosphonic acid (PubChem CID 18757044) has the molecular formula C8H10NO4P and a molecular weight of 215.14 g/mol. Its IUPAC name is (3-hydroxy-3-pyridin-3-ylprop-1-en-2-yl)phosphonic acid.
| Compound Name | (3-hydroxy-3-pyridin-3-ylprop-1-en-2-yl)phosphonic acid |
|---|---|
| PubChem CID | 18757044 |
| Molecular Formula | C8H10NO4P |
| Molecular Weight | 215.14 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | (3-hydroxy-3-pyridin-3-ylprop-1-en-2-yl)phosphonic acid |
| SMILES | C=C(C(O)c1cccnc1)P(=O)(O)O |
| InChI | InChI=1S/C8H10NO4P/c1-6(14(11,12)13)8(10)7-3-2-4-9-5-7/h2-5,8,10H,1H2,(H2,11,12,13) |
| InChIKey | WPEDGKUITDJAFU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.14 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|