C13H14F3NO3 — CID 175269630
4,4,4-trifluorobutan-2-yl 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate (PubChem CID 175269630) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 4,4,4-trifluorobutan-2-yl 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate.
| Compound Name | 4,4,4-trifluorobutan-2-yl 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 175269630 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4,4,4-trifluorobutan-2-yl 2-[hydroxy(pyridin-3-yl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)CC(F)(F)F)C(O)c1cccnc1 |
| InChI | InChI=1S/C13H14F3NO3/c1-8(6-13(14,15)16)20-12(19)9(2)11(18)10-4-3-5-17-7-10/h3-5,7-8,11,18H,2,6H2,1H3 |
| InChIKey | MJDIOXZOGPSJFN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|