C22H31ClO7 — CID 171117858
[(1S,2S,3R,4R,7R,8S,12S,13S,16R,17R)-8-chloro-2,3,16-trihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-14-en-12-yl] acetate (PubChem CID 171117858) has the molecular formula C22H31ClO7 and a molecular weight of 442.94 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7R,8S,12S,13S,16R,17R)-8-chloro-2,3,16-trihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-14-en-12-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,7R,8S,12S,13S,16R,17R)-8-chloro-2,3,16-trihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-14-en-12-yl] acetate |
|---|---|
| PubChem CID | 171117858 |
| Molecular Formula | C22H31ClO7 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | [(1S,2S,3R,4R,7R,8S,12S,13S,16R,17R)-8-chloro-2,3,16-trihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadec-14-en-12-yl] acetate |
| SMILES | C=C1CC[C@H](OC(C)=O)[C@@]2(C)C=C[C@@H](O)[C@H](C)[C@@H]2[C@H](O)[C@]2(O)[C@@H](C)C(=O)O[C@H]2[C@H]1Cl |
| InChI | InChI=1S/C22H31ClO7/c1-10-6-7-15(29-13(4)24)21(5)9-8-14(25)11(2)16(21)18(26)22(28)12(3)20(27)30-19(22)17(10)23/h8-9,11-12,14-19,25-26,28H,1,6-7H2,2-5H3/t11-,12-,14+,15-,16+,17-,18-,19-,21+,22+/m0/s1 |
| InChIKey | DPYWJOPGFSAAOV-QVOPNDTESA-N |
| XLogP | 1.72 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|