C24H33ClO10 — CID 74000243
(2-acetyloxy-8-chloro-3,12,17-trihydroxy-4,13,18-trimethyl-9-methylidene-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadecan-11-yl) acetate (PubChem CID 74000243) has the molecular formula C24H33ClO10 and a molecular weight of 516.97 g/mol. Its IUPAC name is (2-acetyloxy-8-chloro-3,12,17-trihydroxy-4,13,18-trimethyl-9-methylidene-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadecan-11-yl) acetate.
| Compound Name | (2-acetyloxy-8-chloro-3,12,17-trihydroxy-4,13,18-trimethyl-9-methylidene-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadecan-11-yl) acetate |
|---|---|
| PubChem CID | 74000243 |
| Molecular Formula | C24H33ClO10 |
| Molecular Weight | 516.97 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | (2-acetyloxy-8-chloro-3,12,17-trihydroxy-4,13,18-trimethyl-9-methylidene-5-oxo-6,15-dioxatetracyclo[11.5.0.03,7.014,16]octadecan-11-yl) acetate |
| SMILES | C=C1CC(OC(C)=O)C(O)C2(C)C3OC3C(O)C(C)C2C(OC(C)=O)C2(O)C(C)C(=O)OC2C1Cl |
| InChI | InChI=1S/C24H33ClO10/c1-8-7-13(32-11(4)26)18(29)23(6)14(9(2)16(28)17-21(23)34-17)19(33-12(5)27)24(31)10(3)22(30)35-20(24)15(8)25/h9-10,13-21,28-29,31H,1,7H2,2-6H3 |
| InChIKey | AYIZSGQPSXLLKA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 152.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.97 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|