C29H39ClO11 — CID 162962793
(2,7,9-triacetyloxy-13-chloro-4,8,11,17-tetramethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecan-5-yl) acetate (PubChem CID 162962793) has the molecular formula C29H39ClO11 and a molecular weight of 599.07 g/mol. Its IUPAC name is (2,7,9-triacetyloxy-13-chloro-4,8,11,17-tetramethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecan-5-yl) acetate.
| Compound Name | (2,7,9-triacetyloxy-13-chloro-4,8,11,17-tetramethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecan-5-yl) acetate |
|---|---|
| PubChem CID | 162962793 |
| Molecular Formula | C29H39ClO11 |
| Molecular Weight | 599.07 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | (2,7,9-triacetyloxy-13-chloro-4,8,11,17-tetramethyl-12-methylidene-16-oxo-15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecan-5-yl) acetate |
| SMILES | C=C1C(Cl)C2OC(=O)C(C)C23OC1(C)CC(OC(C)=O)C1(C)C(OC(C)=O)CC(OC(C)=O)C(C)C1C3OC(C)=O |
| InChI | InChI=1S/C29H39ClO11/c1-12-19(36-15(4)31)10-20(37-16(5)32)28(9)21(38-17(6)33)11-27(8)13(2)23(30)25-29(41-27,14(3)26(35)40-25)24(22(12)28)39-18(7)34/h12,14,19-25H,2,10-11H2,1,3-9H3 |
| InChIKey | SONOSBQXFLXCLL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.07 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|