C28H35ClO13 — CID 72955353
(2,5,9-triacetyloxy-13-chloro-11-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate (PubChem CID 72955353) has the molecular formula C28H35ClO13 and a molecular weight of 615.03 g/mol. Its IUPAC name is (2,5,9-triacetyloxy-13-chloro-11-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate.
| Compound Name | (2,5,9-triacetyloxy-13-chloro-11-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate |
|---|---|
| PubChem CID | 72955353 |
| Molecular Formula | C28H35ClO13 |
| Molecular Weight | 615.03 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | (2,5,9-triacetyloxy-13-chloro-11-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate |
| SMILES | C=C1C(Cl)C2OC(=O)C(C)C23OC1(O)CC(OC(C)=O)C1(C)C(OC(C)=O)CC(OC(C)=O)C2(CO2)C1C3OC(C)=O |
| InChI | InChI=1S/C28H35ClO13/c1-11-20(29)22-28(12(2)24(34)41-22)23(40-16(6)33)21-25(7,19(39-15(5)32)9-27(11,35)42-28)17(37-13(3)30)8-18(38-14(4)31)26(21)10-36-26/h12,17-23,35H,1,8-10H2,2-7H3 |
| InChIKey | PCTFQDOJTVVEJX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 173.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.03 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|