C26H33ClO11 — CID 163113537
(2,9-diacetyloxy-13-chloro-10-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate (PubChem CID 163113537) has the molecular formula C26H33ClO11 and a molecular weight of 556.99 g/mol. Its IUPAC name is (2,9-diacetyloxy-13-chloro-10-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate.
| Compound Name | (2,9-diacetyloxy-13-chloro-10-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate |
|---|---|
| PubChem CID | 163113537 |
| Molecular Formula | C26H33ClO11 |
| Molecular Weight | 556.99 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | (2,9-diacetyloxy-13-chloro-10-hydroxy-8,17-dimethyl-12-methylidene-16-oxospiro[15,18-dioxatetracyclo[9.6.1.01,14.03,8]octadecane-4,2'-oxirane]-7-yl) acetate |
| SMILES | C=C1C(Cl)C2OC(=O)C(C)C23OC1C(O)C(OC(C)=O)C1(C)C(OC(C)=O)CCC2(CO2)C1C3OC(C)=O |
| InChI | InChI=1S/C26H33ClO11/c1-10-16(27)20-26(11(2)23(32)37-20)22(36-14(5)30)19-24(6,21(35-13(4)29)17(31)18(10)38-26)15(34-12(3)28)7-8-25(19)9-33-25/h11,15-22,31H,1,7-9H2,2-6H3 |
| InChIKey | SMWMKYIAOKDOBB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.99 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|