C28H37ClO12 — CID 163111439
(2,10,12-triacetyloxy-8-chloro-3-hydroxy-4,13-dimethyl-9-methylidene-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-14-yl) acetate (PubChem CID 163111439) has the molecular formula C28H37ClO12 and a molecular weight of 601.05 g/mol. Its IUPAC name is (2,10,12-triacetyloxy-8-chloro-3-hydroxy-4,13-dimethyl-9-methylidene-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-14-yl) acetate.
| Compound Name | (2,10,12-triacetyloxy-8-chloro-3-hydroxy-4,13-dimethyl-9-methylidene-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-14-yl) acetate |
|---|---|
| PubChem CID | 163111439 |
| Molecular Formula | C28H37ClO12 |
| Molecular Weight | 601.05 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | (2,10,12-triacetyloxy-8-chloro-3-hydroxy-4,13-dimethyl-9-methylidene-5-oxospiro[6-oxatricyclo[11.4.0.03,7]heptadecane-17,2'-oxirane]-14-yl) acetate |
| SMILES | C=C1C(OC(C)=O)CC(OC(C)=O)C2(C)C(OC(C)=O)CCC3(CO3)C2C(OC(C)=O)C2(O)C(C)C(=O)OC2C1Cl |
| InChI | InChI=1S/C28H37ClO12/c1-12-18(37-14(3)30)10-20(39-16(5)32)26(7)19(38-15(4)31)8-9-27(11-36-27)22(26)24(40-17(6)33)28(35)13(2)25(34)41-23(28)21(12)29/h13,18-24,35H,1,8-11H2,2-7H3 |
| InChIKey | NCPUGEVJZGDNJY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.05 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|