C24H29ClO10 — CID 171119881
[(2R,5R,6S,9R,10S,11S,15S,16S,17S)-15-acetyloxy-6-chloro-9-hydroxy-2,11,15-trimethyl-7-methylidene-3,14-dioxo-4,18-dioxatetracyclo[8.7.1.01,5.011,16]octadec-12-en-17-yl] 2-hydroxyacetate (PubChem CID 171119881) has the molecular formula C24H29ClO10 and a molecular weight of 512.94 g/mol. Its IUPAC name is [(2R,5R,6S,9R,10S,11S,15S,16S,17S)-15-acetyloxy-6-chloro-9-hydroxy-2,11,15-trimethyl-7-methylidene-3,14-dioxo-4,18-dioxatetracyclo[8.7.1.01,5.011,16]octadec-12-en-17-yl] 2-hydroxyacetate.
| Compound Name | [(2R,5R,6S,9R,10S,11S,15S,16S,17S)-15-acetyloxy-6-chloro-9-hydroxy-2,11,15-trimethyl-7-methylidene-3,14-dioxo-4,18-dioxatetracyclo[8.7.1.01,5.011,16]octadec-12-en-17-yl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 171119881 |
| Molecular Formula | C24H29ClO10 |
| Molecular Weight | 512.94 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [(2R,5R,6S,9R,10S,11S,15S,16S,17S)-15-acetyloxy-6-chloro-9-hydroxy-2,11,15-trimethyl-7-methylidene-3,14-dioxo-4,18-dioxatetracyclo[8.7.1.01,5.011,16]octadec-12-en-17-yl] 2-hydroxyacetate |
| SMILES | C=C1C[C@@H](O)[C@H]2OC3(C(C)C(=O)O[C@H]3[C@H]1Cl)[C@@H](OC(=O)CO)[C@@H]1[C@]2(C)C=CC(=O)[C@@]1(C)OC(C)=O |
| InChI | InChI=1S/C24H29ClO10/c1-10-8-13(28)18-22(4)7-6-14(29)23(5,34-12(3)27)17(22)20(32-15(30)9-26)24(35-18)11(2)21(31)33-19(24)16(10)25/h6-7,11,13,16-20,26,28H,1,8-9H2,2-5H3/t11?,13-,16+,17-,18-,19+,20+,22+,23-,24?/m1/s1 |
| InChIKey | UGMOKXHYLFTUHH-KMJVXMNHSA-N |
| XLogP | 0.60 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.94 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|