C26H33ClO10 — CID 163010589
[(1S,2R,3R,4R,7R,8S,10Z,12R,13S,16R,17S)-2,16-diacetyloxy-8-chloro-3,17-dihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-10,14-dien-12-yl] acetate (PubChem CID 163010589) has the molecular formula C26H33ClO10 and a molecular weight of 540.99 g/mol. Its IUPAC name is [(1S,2R,3R,4R,7R,8S,10Z,12R,13S,16R,17S)-2,16-diacetyloxy-8-chloro-3,17-dihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-10,14-dien-12-yl] acetate.
| Compound Name | [(1S,2R,3R,4R,7R,8S,10Z,12R,13S,16R,17S)-2,16-diacetyloxy-8-chloro-3,17-dihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-10,14-dien-12-yl] acetate |
|---|---|
| PubChem CID | 163010589 |
| Molecular Formula | C26H33ClO10 |
| Molecular Weight | 540.99 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | [(1S,2R,3R,4R,7R,8S,10Z,12R,13S,16R,17S)-2,16-diacetyloxy-8-chloro-3,17-dihydroxy-4,13,17-trimethyl-9-methylidene-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-10,14-dien-12-yl] acetate |
| SMILES | C=C1/C=C\[C@@H](OC(C)=O)[C@@]2(C)C=C[C@@H](OC(C)=O)[C@@](C)(O)[C@@H]2[C@@H](OC(C)=O)[C@]2(O)[C@@H](C)C(=O)O[C@H]2[C@H]1Cl |
| InChI | InChI=1S/C26H33ClO10/c1-12-8-9-17(34-14(3)28)24(6)11-10-18(35-15(4)29)25(7,32)20(24)22(36-16(5)30)26(33)13(2)23(31)37-21(26)19(12)27/h8-11,13,17-22,32-33H,1H2,2-7H3/b9-8-/t13-,17+,18+,19-,20+,21-,22+,24+,25+,26-/m0/s1 |
| InChIKey | AGDFENFYSVKDGA-IYQIXORUSA-N |
| XLogP | 1.75 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.99 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|