C24H29ClO9 — CID 10951151
[(1S,2S,3R,4R,7R,8S,10S,11E,13S,17S)-17-acetyloxy-8-chloro-3,10-dihydroxy-4,13,17-trimethyl-9-methylidene-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-11,14-dien-2-yl] acetate (PubChem CID 10951151) has the molecular formula C24H29ClO9 and a molecular weight of 496.94 g/mol. Its IUPAC name is [(1S,2S,3R,4R,7R,8S,10S,11E,13S,17S)-17-acetyloxy-8-chloro-3,10-dihydroxy-4,13,17-trimethyl-9-methylidene-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-11,14-dien-2-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,7R,8S,10S,11E,13S,17S)-17-acetyloxy-8-chloro-3,10-dihydroxy-4,13,17-trimethyl-9-methylidene-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-11,14-dien-2-yl] acetate |
|---|---|
| PubChem CID | 10951151 |
| Molecular Formula | C24H29ClO9 |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | [(1S,2S,3R,4R,7R,8S,10S,11E,13S,17S)-17-acetyloxy-8-chloro-3,10-dihydroxy-4,13,17-trimethyl-9-methylidene-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-11,14-dien-2-yl] acetate |
| SMILES | C=C1[C@@H](O)/C=C/[C@@]2(C)C=CC(=O)[C@@](C)(OC(C)=O)[C@@H]2[C@H](OC(C)=O)[C@]2(O)[C@@H](C)C(=O)O[C@H]2[C@H]1Cl |
| InChI | InChI=1S/C24H29ClO9/c1-11-15(28)7-9-22(5)10-8-16(29)23(6,34-14(4)27)18(22)20(32-13(3)26)24(31)12(2)21(30)33-19(24)17(11)25/h7-10,12,15,17-20,28,31H,1H2,2-6H3/b9-7+/t12-,15-,17-,18+,19-,20-,22-,23+,24-/m0/s1 |
| InChIKey | NIDIDTZFSMDCLV-PHJCYIMSSA-N |
| XLogP | 1.39 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|