C28H38O11 — CID 162873885
[(1S,2S,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-2,5,7-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate (PubChem CID 162873885) has the molecular formula C28H38O11 and a molecular weight of 550.60 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-2,5,7-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate.
| Compound Name | [(1S,2S,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-2,5,7-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate |
|---|---|
| PubChem CID | 162873885 |
| Molecular Formula | C28H38O11 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | [(1S,2S,3S,4R,5S,7S,8S,9R,12Z,14S,17R)-2,5,7-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadec-12-en-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](OC(C)=O)[C@@]2(C)[C@H]([C@H]1C)[C@H](OC(C)=O)[C@]13O[C@@]1(C)C(=O)O[C@H]3/C=C(/C)CC[C@H]2OC(C)=O |
| InChI | InChI=1S/C28H38O11/c1-13-9-10-20(35-16(4)30)26(7)21(36-17(5)31)12-19(34-15(3)29)14(2)23(26)24(37-18(6)32)28-22(11-13)38-25(33)27(28,8)39-28/h11,14,19-24H,9-10,12H2,1-8H3/b13-11-/t14-,19-,20+,21-,22-,23+,24-,26-,27-,28-/m0/s1 |
| InChIKey | WRYYYJGXEFMEDX-UGOGCOLBSA-N |
| XLogP | 2.57 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|